C22H28N2O — CID 93321080
(3R)-4-benzyl-1-(4-tert-butylphenyl)-3-methylpiperazin-2-one (PubChem CID 93321080) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (3R)-4-benzyl-1-(4-tert-butylphenyl)-3-methylpiperazin-2-one.
| Compound Name | (3R)-4-benzyl-1-(4-tert-butylphenyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 93321080 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (3R)-4-benzyl-1-(4-tert-butylphenyl)-3-methylpiperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(c2ccc(C(C)(C)C)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c1-17-21(25)24(20-12-10-19(11-13-20)22(2,3)4)15-14-23(17)16-18-8-6-5-7-9-18/h5-13,17H,14-16H2,1-4H3/t17-/m1/s1 |
| InChIKey | PPQIGKLGOILCBT-QGZVFWFLSA-N |
| XLogP | 4.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |