C27H27F2N3O2 — CID 93324204
3,5-difluoro-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide (PubChem CID 93324204) has the molecular formula C27H27F2N3O2 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3,5-difluoro-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide.
| Compound Name | 3,5-difluoro-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 93324204 |
| Molecular Formula | C27H27F2N3O2 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3,5-difluoro-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1N1CCC(NC(=O)c2cc(F)cc(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H27F2N3O2/c1-18(19-7-3-2-4-8-19)30-27(34)24-9-5-6-10-25(24)32-13-11-23(12-14-32)31-26(33)20-15-21(28)17-22(29)16-20/h2-10,15-18,23H,11-14H2,1H3,(H,30,34)(H,31,33)/t18-/m0/s1 |
| InChIKey | ATPUXTSJCPFMPS-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |