C25H34N4O2 — CID 93324345
2-[4-(tert-butylcarbamoylamino)piperidin-1-yl]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 93324345) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[4-(tert-butylcarbamoylamino)piperidin-1-yl]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-[4-(tert-butylcarbamoylamino)piperidin-1-yl]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 93324345 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-[4-(tert-butylcarbamoylamino)piperidin-1-yl]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1N1CCC(NC(=O)NC(C)(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H34N4O2/c1-18(19-10-6-5-7-11-19)26-23(30)21-12-8-9-13-22(21)29-16-14-20(15-17-29)27-24(31)28-25(2,3)4/h5-13,18,20H,14-17H2,1-4H3,(H,26,30)(H2,27,28,31)/t18-/m1/s1 |
| InChIKey | SPSUWQNOMYDMSB-GOSISDBHSA-N |
| XLogP | 4.24 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |