C29H33N3O4 — CID 93290995
3,4-dimethoxy-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide (PubChem CID 93290995) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 93290995 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 3,4-dimethoxy-N-[1-[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]piperidin-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(c3ccccc3C(=O)N[C@@H](C)c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C29H33N3O4/c1-20(21-9-5-4-6-10-21)30-29(34)24-11-7-8-12-25(24)32-17-15-23(16-18-32)31-28(33)22-13-14-26(35-2)27(19-22)36-3/h4-14,19-20,23H,15-18H2,1-3H3,(H,30,34)(H,31,33)/t20-/m0/s1 |
| InChIKey | YFCOIQHYXLKJFW-FQEVSTJZSA-N |
| XLogP | 4.59 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |