C21H18FN3O2 — CID 93330677
(3R)-N-(3-fluorophenyl)-2-oxo-1-(2-pyrrol-1-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 93330677) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is (3R)-N-(3-fluorophenyl)-2-oxo-1-(2-pyrrol-1-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(3-fluorophenyl)-2-oxo-1-(2-pyrrol-1-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93330677 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (3R)-N-(3-fluorophenyl)-2-oxo-1-(2-pyrrol-1-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)[C@H]1CCN(c2ccccc2-n2cccc2)C1=O |
| InChI | InChI=1S/C21H18FN3O2/c22-15-6-5-7-16(14-15)23-20(26)17-10-13-25(21(17)27)19-9-2-1-8-18(19)24-11-3-4-12-24/h1-9,11-12,14,17H,10,13H2,(H,23,26)/t17-/m1/s1 |
| InChIKey | QKRFJRJJIDKPTR-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|