C16H19FN2O3 — CID 95317737
N-(3-fluorophenyl)-1-[(3R)-2-oxooxolan-3-yl]piperidine-4-carboxamide (PubChem CID 95317737) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is N-(3-fluorophenyl)-1-[(3R)-2-oxooxolan-3-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-1-[(3R)-2-oxooxolan-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95317737 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(3-fluorophenyl)-1-[(3R)-2-oxooxolan-3-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)C1CCN([C@@H]2CCOC2=O)CC1 |
| InChI | InChI=1S/C16H19FN2O3/c17-12-2-1-3-13(10-12)18-15(20)11-4-7-19(8-5-11)14-6-9-22-16(14)21/h1-3,10-11,14H,4-9H2,(H,18,20)/t14-/m1/s1 |
| InChIKey | PLXKKYIUKSJNHS-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |