C20H20ClNO4 — CID 9333216
(4-chlorophenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate (PubChem CID 9333216) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate.
| Compound Name | (4-chlorophenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 9333216 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (4-chlorophenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate |
| SMILES | O=C(CCC(=O)c1ccccc1)NCCC(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO4/c21-17-8-6-15(7-9-17)14-26-20(25)12-13-22-19(24)11-10-18(23)16-4-2-1-3-5-16/h1-9H,10-14H2,(H,22,24) |
| InChIKey | HZZJKJRLUDENPI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |