C17H17N3O3S2 — CID 9334520
5,6-dimethyl-2-(2-nitrophenyl)sulfanyl-3-propan-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 9334520) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 5,6-dimethyl-2-(2-nitrophenyl)sulfanyl-3-propan-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-(2-nitrophenyl)sulfanyl-3-propan-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9334520 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 5,6-dimethyl-2-(2-nitrophenyl)sulfanyl-3-propan-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(Sc3ccccc3[N+](=O)[O-])n(C(C)C)c(=O)c2c1C |
| InChI | InChI=1S/C17H17N3O3S2/c1-9(2)19-16(21)14-10(3)11(4)24-15(14)18-17(19)25-13-8-6-5-7-12(13)20(22)23/h5-9H,1-4H3 |
| InChIKey | QRAAKWFBFHXUBB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|