C22H18N4O4 — CID 9334578
(E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3-phenoxyphenyl)prop-2-enenitrile (PubChem CID 9334578) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3-phenoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3-phenoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9334578 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3-phenoxyphenyl)prop-2-enenitrile |
| SMILES | Cn1c(N)c(C(=O)/C(C#N)=C/c2cccc(Oc3ccccc3)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H18N4O4/c1-25-20(24)18(21(28)26(2)22(25)29)19(27)15(13-23)11-14-7-6-10-17(12-14)30-16-8-4-3-5-9-16/h3-12H,24H2,1-2H3/b15-11+ |
| InChIKey | GBYSXGAWZBRWBJ-RVDMUPIBSA-N |
| XLogP | 2.25 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|