C16H12Cl2N4O3 — CID 9334556
(E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 9334556) has the molecular formula C16H12Cl2N4O3 and a molecular weight of 379.20 g/mol. Its IUPAC name is (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9334556 |
| Molecular Formula | C16H12Cl2N4O3 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | Cn1c(N)c(C(=O)/C(C#N)=C/c2ccc(Cl)c(Cl)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H12Cl2N4O3/c1-21-14(20)12(15(24)22(2)16(21)25)13(23)9(7-19)5-8-3-4-10(17)11(18)6-8/h3-6H,20H2,1-2H3/b9-5+ |
| InChIKey | DJMGZPSEYZVSAH-WEVVVXLNSA-N |
| XLogP | 1.76 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|