C14H13N5O3S — CID 9334817
(E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enenitrile (PubChem CID 9334817) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9334817 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (E)-2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enenitrile |
| SMILES | Cc1nc(/C=C(\C#N)C(=O)c2c(N)n(C)c(=O)n(C)c2=O)cs1 |
| InChI | InChI=1S/C14H13N5O3S/c1-7-17-9(6-23-7)4-8(5-15)11(20)10-12(16)18(2)14(22)19(3)13(10)21/h4,6H,16H2,1-3H3/b8-4+ |
| InChIKey | OEUHMVBMFYTGLR-XBXARRHUSA-N |
| XLogP | 0.22 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|