C19H15N3O2S — CID 9335105
(E)-2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 9335105) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9335105 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (E)-2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)/C(C#N)=C/c3ccco3)n2)c1 |
| InChI | InChI=1S/C19H15N3O2S/c1-12-5-6-13(2)16(8-12)17-11-25-19(21-17)22-18(23)14(10-20)9-15-4-3-7-24-15/h3-9,11H,1-2H3,(H,21,22,23)/b14-9+ |
| InChIKey | AVJROOPFRQTOHB-NTEUORMPSA-N |
| XLogP | 4.57 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|