C17H18N2O2 — CID 9336109
(E)-3-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(furan-2-carbonyl)prop-2-enenitrile (PubChem CID 9336109) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(furan-2-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(furan-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9336109 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(furan-2-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)c2ccco2)c(C)n1C(C)C |
| InChI | InChI=1S/C17H18N2O2/c1-11(2)19-12(3)8-14(13(19)4)9-15(10-18)17(20)16-6-5-7-21-16/h5-9,11H,1-4H3/b15-9+ |
| InChIKey | QKRVORIDDDLTGD-OQLLNIDSSA-N |
| XLogP | 4.07 |
| TPSA | 58.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|