C14H29N3O2 — CID 93373549
(2S)-2-amino-N-[2-oxo-2-(propylamino)ethyl]-N-propylhexanamide (PubChem CID 93373549) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-oxo-2-(propylamino)ethyl]-N-propylhexanamide.
| Compound Name | (2S)-2-amino-N-[2-oxo-2-(propylamino)ethyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 93373549 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (2S)-2-amino-N-[2-oxo-2-(propylamino)ethyl]-N-propylhexanamide |
| SMILES | CCCC[C@H](N)C(=O)N(CCC)CC(=O)NCCC |
| InChI | InChI=1S/C14H29N3O2/c1-4-7-8-12(15)14(19)17(10-6-3)11-13(18)16-9-5-2/h12H,4-11,15H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | HHXIRWLHTLEIGY-LBPRGKRZSA-N |
| XLogP | 1.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |