C20H24N4O3S — CID 9340490
N-[[5,6-dimethyl-4-(3-methyl-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-yl]methyl]-N-ethylethanamine (PubChem CID 9340490) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[[5,6-dimethyl-4-(3-methyl-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-yl]methyl]-N-ethylethanamine.
| Compound Name | N-[[5,6-dimethyl-4-(3-methyl-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-yl]methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 9340490 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[[5,6-dimethyl-4-(3-methyl-4-nitrophenoxy)thieno[2,3-d]pyrimidin-2-yl]methyl]-N-ethylethanamine |
| SMILES | CCN(CC)Cc1nc(Oc2ccc([N+](=O)[O-])c(C)c2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C20H24N4O3S/c1-6-23(7-2)11-17-21-19(18-13(4)14(5)28-20(18)22-17)27-15-8-9-16(24(25)26)12(3)10-15/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | QRJWKRYAAKGTSA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|