C20H23N4O4S+ — CID 9111830
diethyl-[[4-(4-formyl-2-nitrophenoxy)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium (PubChem CID 9111830) has the molecular formula C20H23N4O4S+ and a molecular weight of 415.50 g/mol. Its IUPAC name is diethyl-[[4-(4-formyl-2-nitrophenoxy)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium.
| Compound Name | diethyl-[[4-(4-formyl-2-nitrophenoxy)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 9111830 |
| Molecular Formula | C20H23N4O4S+ |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | diethyl-[[4-(4-formyl-2-nitrophenoxy)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1nc(Oc2ccc(C=O)cc2[N+](=O)[O-])c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C20H22N4O4S/c1-5-23(6-2)10-17-21-19(18-12(3)13(4)29-20(18)22-17)28-16-8-7-14(11-25)9-15(16)24(26)27/h7-9,11H,5-6,10H2,1-4H3/p+1 |
| InChIKey | QWPBWSVFAJYYOF-UHFFFAOYSA-O |
| XLogP | 3.25 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|