C16H13N3O4S2 — CID 8840604
4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-3-nitrobenzaldehyde (PubChem CID 8840604) has the molecular formula C16H13N3O4S2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-3-nitrobenzaldehyde.
| Compound Name | 4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 8840604 |
| Molecular Formula | C16H13N3O4S2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 4-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-3-nitrobenzaldehyde |
| SMILES | Cc1sc2nc(CSc3ccc(C=O)cc3[N+](=O)[O-])[nH]c(=O)c2c1C |
| InChI | InChI=1S/C16H13N3O4S2/c1-8-9(2)25-16-14(8)15(21)17-13(18-16)7-24-12-4-3-10(6-20)5-11(12)19(22)23/h3-6H,7H2,1-2H3,(H,17,18,21) |
| InChIKey | GZQOTBKOUXWLIH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|