C13H17Cl2N3O — CID 93452783
1-[(1R,2R)-2-aminocyclohexyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 93452783) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.21 g/mol. Its IUPAC name is 1-[(1R,2R)-2-aminocyclohexyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(1R,2R)-2-aminocyclohexyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 93452783 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[(1R,2R)-2-aminocyclohexyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O/c14-9-6-5-8(7-10(9)15)17-13(19)18-12-4-2-1-3-11(12)16/h5-7,11-12H,1-4,16H2,(H2,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | XFLFOBISFCIVQB-VXGBXAGGSA-N |
| XLogP | 3.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |