C17H16Cl2N4O4 — CID 9345745
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-2-(3-nitroanilino)acetamide (PubChem CID 9345745) has the molecular formula C17H16Cl2N4O4 and a molecular weight of 411.25 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-2-(3-nitroanilino)acetamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-2-(3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 9345745 |
| Molecular Formula | C17H16Cl2N4O4 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-2-(3-nitroanilino)acetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)CNc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16Cl2N4O4/c1-22(10-15(24)21-17-13(18)6-3-7-14(17)19)16(25)9-20-11-4-2-5-12(8-11)23(26)27/h2-8,20H,9-10H2,1H3,(H,21,24) |
| InChIKey | LFGUAAFETPJHFX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|