C23H30N7O4+ — CID 93474711
trimethyl-[2-[(2E)-2-[(3E)-4-(2-methylanilino)-3-[(4-methyl-2-nitrophenyl)hydrazinylidene]-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]azanium (PubChem CID 93474711) has the molecular formula C23H30N7O4+ and a molecular weight of 468.54 g/mol. Its IUPAC name is trimethyl-[2-[(2E)-2-[(3E)-4-(2-methylanilino)-3-[(4-methyl-2-nitrophenyl)hydrazinylidene]-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]azanium.
| Compound Name | trimethyl-[2-[(2E)-2-[(3E)-4-(2-methylanilino)-3-[(4-methyl-2-nitrophenyl)hydrazinylidene]-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 93474711 |
| Molecular Formula | C23H30N7O4+ |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | trimethyl-[2-[(2E)-2-[(3E)-4-(2-methylanilino)-3-[(4-methyl-2-nitrophenyl)hydrazinylidene]-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]azanium |
| SMILES | CC(=N\NC(=O)C[N+](C)(C)C)/C(=N\Nc1ccc(C)cc1[N+](=O)[O-])C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C23H29N7O4/c1-15-11-12-19(20(13-15)29(33)34)26-28-22(17(3)25-27-21(31)14-30(4,5)6)23(32)24-18-10-8-7-9-16(18)2/h7-13H,14H2,1-6H3,(H2-,24,25,26,27,28,31,32)/p+1 |
| InChIKey | QZPZCYGCWUOQIK-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|