C19H22N8O3 — CID 125115588
(3Z)-3-(diaminomethylidenehydrazinylidene)-2-[(4-methyl-2-nitrophenyl)hydrazinylidene]-N-(2-methylphenyl)butanamide (PubChem CID 125115588) has the molecular formula C19H22N8O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is (3Z)-3-(diaminomethylidenehydrazinylidene)-2-[(4-methyl-2-nitrophenyl)hydrazinylidene]-N-(2-methylphenyl)butanamide.
| Compound Name | (3Z)-3-(diaminomethylidenehydrazinylidene)-2-[(4-methyl-2-nitrophenyl)hydrazinylidene]-N-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 125115588 |
| Molecular Formula | C19H22N8O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3Z)-3-(diaminomethylidenehydrazinylidene)-2-[(4-methyl-2-nitrophenyl)hydrazinylidene]-N-(2-methylphenyl)butanamide |
| SMILES | C/C(=N/N=C(N)N)C(=NNc1ccc(C)cc1[N+](=O)[O-])C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C19H22N8O3/c1-11-8-9-15(16(10-11)27(29)30)24-25-17(13(3)23-26-19(20)21)18(28)22-14-7-5-4-6-12(14)2/h4-10,24H,1-3H3,(H,22,28)(H4,20,21,26)/b23-13-,25-17? |
| InChIKey | MUXGXZPMQXVLNA-JCUTXWQJSA-N |
| XLogP | 2.27 |
| TPSA | 173.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|