C12H16N6O2 — CID 135922317
(2E,3E)-3-(diaminomethylidenehydrazinylidene)-2-hydroxyimino-N-(2-methylphenyl)butanamide (PubChem CID 135922317) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is (2E,3E)-3-(diaminomethylidenehydrazinylidene)-2-hydroxyimino-N-(2-methylphenyl)butanamide.
| Compound Name | (2E,3E)-3-(diaminomethylidenehydrazinylidene)-2-hydroxyimino-N-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 135922317 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2E,3E)-3-(diaminomethylidenehydrazinylidene)-2-hydroxyimino-N-(2-methylphenyl)butanamide |
| SMILES | CC(=N\N=C(N)N)/C(=N\O)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C12H16N6O2/c1-7-5-3-4-6-9(7)15-11(19)10(18-20)8(2)16-17-12(13)14/h3-6,20H,1-2H3,(H,15,19)(H4,13,14,17)/b16-8+,18-10+ |
| InChIKey | WITOOYSPFRHWOY-DKHJZJQXSA-N |
| XLogP | 0.41 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|