C19H17N3O3 — CID 934922
(4S)-4'-acetyl-2-amino-5'-methyl-2'-oxo-1'-prop-2-enylspiro[chromene-4,3'-pyrrole]-3-carbonitrile (PubChem CID 934922) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (4S)-4'-acetyl-2-amino-5'-methyl-2'-oxo-1'-prop-2-enylspiro[chromene-4,3'-pyrrole]-3-carbonitrile.
| Compound Name | (4S)-4'-acetyl-2-amino-5'-methyl-2'-oxo-1'-prop-2-enylspiro[chromene-4,3'-pyrrole]-3-carbonitrile |
|---|---|
| PubChem CID | 934922 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (4S)-4'-acetyl-2-amino-5'-methyl-2'-oxo-1'-prop-2-enylspiro[chromene-4,3'-pyrrole]-3-carbonitrile |
| SMILES | C=CCN1C(=O)[C@@]2(C(C#N)=C(N)Oc3ccccc32)C(C(C)=O)=C1C |
| InChI | InChI=1S/C19H17N3O3/c1-4-9-22-11(2)16(12(3)23)19(18(22)24)13-7-5-6-8-15(13)25-17(21)14(19)10-20/h4-8H,1,9,21H2,2-3H3/t19-/m0/s1 |
| InChIKey | DLWOPOLKVGBRDG-IBGZPJMESA-N |
| XLogP | 1.90 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|