C7H12N2O2 — CID 93495295
methyl (3S,6S)-6-methyl-1,2,3,6-tetrahydropyridazine-3-carboxylate (PubChem CID 93495295) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl (3S,6S)-6-methyl-1,2,3,6-tetrahydropyridazine-3-carboxylate.
| Compound Name | methyl (3S,6S)-6-methyl-1,2,3,6-tetrahydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 93495295 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | methyl (3S,6S)-6-methyl-1,2,3,6-tetrahydropyridazine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C=C[C@H](C)NN1 |
| InChI | InChI=1S/C7H12N2O2/c1-5-3-4-6(9-8-5)7(10)11-2/h3-6,8-9H,1-2H3/t5-,6-/m0/s1 |
| InChIKey | DOUZWNKKGIIYTP-WDSKDSINSA-N |
| XLogP | -0.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|