methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride

C11H12ClNO2 — CID 141352867

IUPACmethyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride
SMILESCOC(=O)C1C=Cc2ccccc2N1.Cl
InChIInChI=1S/C11H11NO2.ClH/c1-14-11(13)10-7-6-8-4-2-3-5-9(8)12-10;/h2-7,10,12H,1H3;1H
InChIKeyQUFIGEHLABNGQE-UHFFFAOYSA-N
MW225.68 g/mol
LogP2.09
Rot. Bonds1

About methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride

methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride (PubChem CID 141352867) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride.

Molecular Properties

Compound Namemethyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride
PubChem CID141352867
Molecular FormulaC11H12ClNO2
Molecular Weight225.68 g/mol
Exact Mass225.06
IUPAC Namemethyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride
SMILESCOC(=O)C1C=Cc2ccccc2N1.Cl
InChIInChI=1S/C11H11NO2.ClH/c1-14-11(13)10-7-6-8-4-2-3-5-9(8)12-10;/h2-7,10,12H,1H3;1H
InChIKeyQUFIGEHLABNGQE-UHFFFAOYSA-N
XLogP2.09
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.68
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride?
The IUPAC name of methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride (CID 141352867) is methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride is COC(=O)C1C=Cc2ccccc2N1.Cl.
What is the InChIKey of methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride?
The InChIKey is QUFIGEHLABNGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.ClH/c1-14-11(13)10-7-6-8-4-2-3-5-9(8)12-10;/h2-7,10,12H,1H3;1H.
What are the key properties of methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride?
methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride has a molecular weight of 225.68 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride is sourced from PubChem (CID 141352867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).