C11H12ClNO2 — CID 141352867
methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride (PubChem CID 141352867) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride.
| Compound Name | methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 141352867 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | methyl 1,2-dihydroquinoline-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1C=Cc2ccccc2N1.Cl |
| InChI | InChI=1S/C11H11NO2.ClH/c1-14-11(13)10-7-6-8-4-2-3-5-9(8)12-10;/h2-7,10,12H,1H3;1H |
| InChIKey | QUFIGEHLABNGQE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |