C12H15N — CID 126659011
2-propan-2-yl-1,2-dihydroquinoline (PubChem CID 126659011) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-propan-2-yl-1,2-dihydroquinoline.
| Compound Name | 2-propan-2-yl-1,2-dihydroquinoline |
|---|---|
| PubChem CID | 126659011 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-propan-2-yl-1,2-dihydroquinoline |
| SMILES | CC(C)C1C=Cc2ccccc2N1 |
| InChI | InChI=1S/C12H15N/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11/h3-9,11,13H,1-2H3 |
| InChIKey | LSRABMYSNPZAOZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |