C13H19NSi — CID 11115651
1,2-dihydroquinolin-2-ylmethyl(trimethyl)silane (PubChem CID 11115651) has the molecular formula C13H19NSi and a molecular weight of 217.39 g/mol. Its IUPAC name is 1,2-dihydroquinolin-2-ylmethyl(trimethyl)silane.
| Compound Name | 1,2-dihydroquinolin-2-ylmethyl(trimethyl)silane |
|---|---|
| PubChem CID | 11115651 |
| Molecular Formula | C13H19NSi |
| Molecular Weight | 217.39 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1,2-dihydroquinolin-2-ylmethyl(trimethyl)silane |
| SMILES | C[Si](C)(C)CC1C=Cc2ccccc2N1 |
| InChI | InChI=1S/C13H19NSi/c1-15(2,3)10-12-9-8-11-6-4-5-7-13(11)14-12/h4-9,12,14H,10H2,1-3H3 |
| InChIKey | BHDHZLOLHILUSR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|