C19H29N — CID 126708133
2,6-bis(2,2-dimethylpropyl)-1,2-dihydroquinoline (PubChem CID 126708133) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 2,6-bis(2,2-dimethylpropyl)-1,2-dihydroquinoline.
| Compound Name | 2,6-bis(2,2-dimethylpropyl)-1,2-dihydroquinoline |
|---|---|
| PubChem CID | 126708133 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2,6-bis(2,2-dimethylpropyl)-1,2-dihydroquinoline |
| SMILES | CC(C)(C)Cc1ccc2c(c1)C=CC(CC(C)(C)C)N2 |
| InChI | InChI=1S/C19H29N/c1-18(2,3)12-14-7-10-17-15(11-14)8-9-16(20-17)13-19(4,5)6/h7-11,16,20H,12-13H2,1-6H3 |
| InChIKey | YMSMACICXQGOAF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |