C18H17N3OS — CID 9356496
2-[cyano(cyclopentylidene)methyl]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 9356496) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[cyano(cyclopentylidene)methyl]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[cyano(cyclopentylidene)methyl]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 9356496 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[cyano(cyclopentylidene)methyl]-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(C#N)=C2CCCC2)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H17N3OS/c1-12-16(17(22)21-14-9-3-2-4-10-14)23-18(20-12)15(11-19)13-7-5-6-8-13/h2-4,9-10H,5-8H2,1H3,(H,21,22) |
| InChIKey | WVNOZDKMOCIKER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|