C21H25ClN3O2S+ — CID 9357312
(2S)-2-[4-(2-chlorobenzoyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)propanamide (PubChem CID 9357312) has the molecular formula C21H25ClN3O2S+ and a molecular weight of 418.97 g/mol. Its IUPAC name is (2S)-2-[4-(2-chlorobenzoyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)propanamide.
| Compound Name | (2S)-2-[4-(2-chlorobenzoyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 9357312 |
| Molecular Formula | C21H25ClN3O2S+ |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (2S)-2-[4-(2-chlorobenzoyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccccc1NC(=O)[C@H](C)[NH+]1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H24ClN3O2S/c1-15(20(26)23-18-9-5-6-10-19(18)28-2)24-11-13-25(14-12-24)21(27)16-7-3-4-8-17(16)22/h3-10,15H,11-14H2,1-2H3,(H,23,26)/p+1/t15-/m0/s1 |
| InChIKey | YJHWWGHQOPRTSX-HNNXBMFYSA-O |
| XLogP | 2.43 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |