C23H18N2O3 — CID 9360404
2-(2-cyanophenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzamide (PubChem CID 9360404) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(2-cyanophenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzamide.
| Compound Name | 2-(2-cyanophenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzamide |
|---|---|
| PubChem CID | 9360404 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-(2-cyanophenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzamide |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H18N2O3/c24-15-16-6-1-2-7-18(16)19-8-3-4-9-20(19)23(26)25-17-10-11-21-22(14-17)28-13-5-12-27-21/h1-4,6-11,14H,5,12-13H2,(H,25,26) |
| InChIKey | LGEOXCPICWRKAO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |