C16H18Cl2N2O2 — CID 9364649
(3R)-1-cyclopentyl-N-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 9364649) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is (3R)-1-cyclopentyl-N-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-cyclopentyl-N-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9364649 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (3R)-1-cyclopentyl-N-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)[C@@H]1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c17-12-6-3-7-13(15(12)18)19-16(22)10-8-14(21)20(9-10)11-4-1-2-5-11/h3,6-7,10-11H,1-2,4-5,8-9H2,(H,19,22)/t10-/m1/s1 |
| InChIKey | PLHVLQCQWKTUBF-SNVBAGLBSA-N |
| XLogP | 3.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |