C18H19N3O4S — CID 9366741
(E)-3-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile (PubChem CID 9366741) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (E)-3-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9366741 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (E)-3-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=C(\C#N)C(=O)c1ccoc1C |
| InChI | InChI=1S/C18H19N3O4S/c1-11-17(8-14(9-19)18(22)16-4-6-25-13(16)3)12(2)21(20-11)15-5-7-26(23,24)10-15/h4,6,8,15H,5,7,10H2,1-3H3/b14-8+/t15-/m1/s1 |
| InChIKey | ASXDMORODLPQOD-UJMHRVFCSA-N |
| XLogP | 2.55 |
| TPSA | 105.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|