C23H27N3O3S — CID 9211545
(E)-2-(4-tert-butylbenzoyl)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 9211545) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is (E)-2-(4-tert-butylbenzoyl)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-tert-butylbenzoyl)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 9211545 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (E)-2-(4-tert-butylbenzoyl)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1/C=C(\C#N)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-15-21(16(2)26(25-15)20-10-11-30(28,29)14-20)12-18(13-24)22(27)17-6-8-19(9-7-17)23(3,4)5/h6-9,12,20H,10-11,14H2,1-5H3/b18-12+/t20-/m0/s1 |
| InChIKey | RUHKTAKCGBKSAT-YWFITGJYSA-N |
| XLogP | 3.95 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|