C19H25ClN4O3S — CID 11934444
(E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide (PubChem CID 11934444) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 11934444 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(Cl)c1/C=C(\C#N)C(=O)N[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H25ClN4O3S/c1-12-5-3-4-6-17(12)22-19(25)14(10-21)9-16-13(2)23-24(18(16)20)15-7-8-28(26,27)11-15/h9,12,15,17H,3-8,11H2,1-2H3,(H,22,25)/b14-9+/t12-,15+,17-/m0/s1 |
| InChIKey | VPESISXSIPANIY-WMHCPZOOSA-N |
| XLogP | 2.81 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|