C15H12ClN3O5 — CID 9367127
N'-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoyl]furan-2-carbohydrazide (PubChem CID 9367127) has the molecular formula C15H12ClN3O5 and a molecular weight of 349.73 g/mol. Its IUPAC name is N'-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoyl]furan-2-carbohydrazide.
| Compound Name | N'-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9367127 |
| Molecular Formula | C15H12ClN3O5 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N'-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoyl]furan-2-carbohydrazide |
| SMILES | O=C(CCn1c(=O)oc2cc(Cl)ccc21)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H12ClN3O5/c16-9-3-4-10-12(8-9)24-15(22)19(10)6-5-13(20)17-18-14(21)11-2-1-7-23-11/h1-4,7-8H,5-6H2,(H,17,20)(H,18,21) |
| InChIKey | OWEFJYVMBGUKDE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|