C16H21ClN4O3S — CID 9150561
1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-(3-methylbutyl)thiourea (PubChem CID 9150561) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is 1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-(3-methylbutyl)thiourea.
| Compound Name | 1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 9150561 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-(3-methylbutyl)thiourea |
| SMILES | CC(C)CCNC(=S)NNC(=O)CCn1c(=O)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H21ClN4O3S/c1-10(2)5-7-18-15(25)20-19-14(22)6-8-21-12-4-3-11(17)9-13(12)24-16(21)23/h3-4,9-10H,5-8H2,1-2H3,(H,19,22)(H2,18,20,25) |
| InChIKey | BOSBHCBFEMQENI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|