C19H25ClN4O3S — CID 11937352
1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11937352) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is 1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11937352 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)CCn1c(=O)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H25ClN4O3S/c1-11-4-3-5-14(12(11)2)21-18(28)23-22-17(25)8-9-24-15-7-6-13(20)10-16(15)27-19(24)26/h6-7,10-12,14H,3-5,8-9H2,1-2H3,(H,22,25)(H2,21,23,28)/t11-,12-,14+/m1/s1 |
| InChIKey | XOVCANATHMIBJE-BZPMIXESSA-N |
| XLogP | 2.96 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|