C22H20N6O3 — CID 9369876
3-ethyl-N'-[4-(5-methylpyrazol-1-yl)benzoyl]-4-oxophthalazine-1-carbohydrazide (PubChem CID 9369876) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-ethyl-N'-[4-(5-methylpyrazol-1-yl)benzoyl]-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-ethyl-N'-[4-(5-methylpyrazol-1-yl)benzoyl]-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 9369876 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3-ethyl-N'-[4-(5-methylpyrazol-1-yl)benzoyl]-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2ccc(-n3nccc3C)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H20N6O3/c1-3-27-22(31)18-7-5-4-6-17(18)19(26-27)21(30)25-24-20(29)15-8-10-16(11-9-15)28-14(2)12-13-23-28/h4-13H,3H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | JYPFXSYIDJJMSD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|