C16H15BrFNO3 — CID 9371563
(Z)-N-[(2-bromo-4,5-dimethoxyphenyl)methoxy]-1-(2-fluorophenyl)methanimine (PubChem CID 9371563) has the molecular formula C16H15BrFNO3 and a molecular weight of 368.20 g/mol. Its IUPAC name is (Z)-N-[(2-bromo-4,5-dimethoxyphenyl)methoxy]-1-(2-fluorophenyl)methanimine.
| Compound Name | (Z)-N-[(2-bromo-4,5-dimethoxyphenyl)methoxy]-1-(2-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 9371563 |
| Molecular Formula | C16H15BrFNO3 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | (Z)-N-[(2-bromo-4,5-dimethoxyphenyl)methoxy]-1-(2-fluorophenyl)methanimine |
| SMILES | COc1cc(Br)c(CO/N=C\c2ccccc2F)cc1OC |
| InChI | InChI=1S/C16H15BrFNO3/c1-20-15-7-12(13(17)8-16(15)21-2)10-22-19-9-11-5-3-4-6-14(11)18/h3-9H,10H2,1-2H3/b19-9- |
| InChIKey | FQQNZOHPLHPOMT-OCKHKDLRSA-N |
| XLogP | 4.16 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|