About (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate
(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 9380087) has the molecular formula C11H12N2O4S
and a molecular weight of 268.29 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
Molecular Properties
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| PubChem CID | 9380087 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | Cc1cc(COC(=O)Cn2c(C)csc2=O)on1 |
| InChI | InChI=1S/C11H12N2O4S/c1-7-3-9(17-12-7)5-16-10(14)4-13-8(2)6-18-11(13)15/h3,6H,4-5H2,1-2H3 |
| InChIKey | ZZKRCSIRCIYECB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (CID 9380087) is (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
What is the SMILES notation for (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The canonical SMILES for (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate is Cc1cc(COC(=O)Cn2c(C)csc2=O)on1.
What is the InChIKey of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The InChIKey is ZZKRCSIRCIYECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4S/c1-7-3-9(17-12-7)5-16-10(14)4-13-8(2)6-18-11(13)15/h3,6H,4-5H2,1-2H3.
What are the key properties of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate has a molecular weight of 268.29 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate is sourced from PubChem (CID 9380087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).