C14H22N2O3S — CID 88813501
(3-methyl-1,2-oxazol-5-yl)methyl N-cyclohexylsulfanyl-N-ethylcarbamate (PubChem CID 88813501) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl N-cyclohexylsulfanyl-N-ethylcarbamate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl N-cyclohexylsulfanyl-N-ethylcarbamate |
|---|---|
| PubChem CID | 88813501 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl N-cyclohexylsulfanyl-N-ethylcarbamate |
| SMILES | CCN(SC1CCCCC1)C(=O)OCc1cc(C)no1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-16(20-13-7-5-4-6-8-13)14(17)18-10-12-9-11(2)15-19-12/h9,13H,3-8,10H2,1-2H3 |
| InChIKey | HPCBUFKZMUQRNS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|