C22H17FN2O3S — CID 9380441
2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-methylbenzo[g]quinazolin-4-one (PubChem CID 9380441) has the molecular formula C22H17FN2O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-methylbenzo[g]quinazolin-4-one.
| Compound Name | 2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-methylbenzo[g]quinazolin-4-one |
|---|---|
| PubChem CID | 9380441 |
| Molecular Formula | C22H17FN2O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-methylbenzo[g]quinazolin-4-one |
| SMILES | Cn1c(SCc2cc(F)cc3c2OCOC3)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C22H17FN2O3S/c1-25-21(26)18-8-13-4-2-3-5-14(13)9-19(18)24-22(25)29-11-16-7-17(23)6-15-10-27-12-28-20(15)16/h2-9H,10-12H2,1H3 |
| InChIKey | FTQLBGYJMCAFLI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|