C20H17N3O4 — CID 9380576
(6-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate (PubChem CID 9380576) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate.
| Compound Name | (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 9380576 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (6-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
| SMILES | Cc1ccc2nc(COC(=O)CN3C(=O)Cc4ccccc4C3=O)cn2c1 |
| InChI | InChI=1S/C20H17N3O4/c1-13-6-7-17-21-15(10-22(17)9-13)12-27-19(25)11-23-18(24)8-14-4-2-3-5-16(14)20(23)26/h2-7,9-10H,8,11-12H2,1H3 |
| InChIKey | DAPKDVCJYPTABD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|