C18H13N3O5S — CID 9310620
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate (PubChem CID 9310620) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 9310620 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
| SMILES | O=C(CN1C(=O)Cc2ccccc2C1=O)OCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C18H13N3O5S/c22-15-7-11-3-1-2-4-13(11)18(24)21(15)8-16(23)25-9-14-19-17(20-26-14)12-5-6-27-10-12/h1-6,10H,7-9H2 |
| InChIKey | UUPDVECDONPMFG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|