C23H17N3O5S — CID 27293080
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 27293080) has the molecular formula C23H17N3O5S and a molecular weight of 447.47 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 27293080 |
| Molecular Formula | C23H17N3O5S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)OCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C23H17N3O5S/c27-19(30-12-18-24-21(25-31-18)15-9-11-32-13-15)8-3-10-26-22(28)16-6-1-4-14-5-2-7-17(20(14)16)23(26)29/h1-2,4-7,9,11,13H,3,8,10,12H2 |
| InChIKey | KIFBHUUYLGOVJN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|