C23H18N4O2S — CID 9381228
2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)ethanone (PubChem CID 9381228) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)ethanone.
| Compound Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 9381228 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CSc2ncnc3c2oc2ccccc23)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C23H18N4O2S/c1-14-11-17(15(2)27(14)20-9-5-6-10-24-20)18(28)12-30-23-22-21(25-13-26-23)16-7-3-4-8-19(16)29-22/h3-11,13H,12H2,1-2H3 |
| InChIKey | VXMVISUTLFVJAL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|