C26H21N3O5 — CID 4808349
methyl 4-[2,5-dimethyl-3-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]pyrrol-1-yl]benzoate (PubChem CID 4808349) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is methyl 4-[2,5-dimethyl-3-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dimethyl-3-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 4808349 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | methyl 4-[2,5-dimethyl-3-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)Cn3cnc4c(oc5ccccc54)c3=O)c2C)cc1 |
| InChI | InChI=1S/C26H21N3O5/c1-15-12-20(16(2)29(15)18-10-8-17(9-11-18)26(32)33-3)21(30)13-28-14-27-23-19-6-4-5-7-22(19)34-24(23)25(28)31/h4-12,14H,13H2,1-3H3 |
| InChIKey | VWLUHJQAEVWILZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|