C25H26N4O6 — CID 32828508
methyl 4-[2,5-dimethyl-3-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]pyrrol-1-yl]benzoate (PubChem CID 32828508) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is methyl 4-[2,5-dimethyl-3-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dimethyl-3-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 32828508 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl 4-[2,5-dimethyl-3-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]pyrrol-1-yl]benzoate |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)c2cc(C)n(-c3ccc(C(=O)OC)cc3)c2C)c1=O |
| InChI | InChI=1S/C25H26N4O6/c1-6-12-26-23(32)27(13-7-2)25(34)28(24(26)33)15-21(30)20-14-16(3)29(17(20)4)19-10-8-18(9-11-19)22(31)35-5/h6-11,14H,1-2,12-13,15H2,3-5H3 |
| InChIKey | LZEZWMZOMZQIGC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|