C18H19N3O4S2 — CID 9383386
2-[benzenesulfonyl(1,3-benzothiazol-2-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 9383386) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[benzenesulfonyl(1,3-benzothiazol-2-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[benzenesulfonyl(1,3-benzothiazol-2-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 9383386 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-[benzenesulfonyl(1,3-benzothiazol-2-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(c1nc2ccccc2s1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O4S2/c1-25-12-11-19-17(22)13-21(27(23,24)14-7-3-2-4-8-14)18-20-15-9-5-6-10-16(15)26-18/h2-10H,11-13H2,1H3,(H,19,22) |
| InChIKey | ZBOFDCKBRLVUSP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|